What is partially ordered set, Mathematics

Assignment Help:

What is Partially Ordered Set?  Let  S = {a,b,c} and A = P(S). Draw the Hasse diagram of the poset A with the partial order ⊆ (set inclusion).  

Ans: Let R be a relation defined on a non-empty set A. The mathematical structure (A, R) is set to be a Partial order set or poset if the relation R is a partial order relation on A. 

Any relation R defined on a non-empty set A is said to be a Partial Order Relation, if R is 

  • Reflexive on A i.e., xRx ∀ x∈ A
  • Anti-symmetric on A i.e., xRy and yRx ⇒ x = y and
  • Transitive on A i.e., xRy and yRz ⇒ xRz for x, y, z ∈ A.

A partial order relation is denoted by the symbol '≤'.  A general notation for a poset is (A, ≤), where A is any non-empty set and '≤' is any partial order relation defined on the set A.  The Hasse diagram for the poset (P(S),  ⊆) is as below. The poset has 8 elements - 8 possible subsets of S. Null set is the minimum element and S itself is the maximal element.

 

140_What is Partially Ordered Set.png

 


Related Discussions:- What is partially ordered set

Dy/dx, how do you differentiate sinx/ex?

how do you differentiate sinx/ex?

Describe segments, Describe Segments, Rays, Angles, and Triangles We now...

Describe Segments, Rays, Angles, and Triangles We now define some more basic geometric figures. 1. Segments Definition A segment is the set of two given points and all the

Scalar equation of plane - three dimensional spaces, Scalar Equation of Pla...

Scalar Equation of Plane A little more helpful form of the equations is as follows. Begin with the first form of the vector equation and write a vector for the difference. {

Parseval theorem, Verify the Parseval theorem for the discrete-time signal ...

Verify the Parseval theorem for the discrete-time signal x(n) and its DFT from given equations. Compute the linear convolution of the discrete-time signal x(n) ={3, 2, 2,1} and

Properties of triangle, In triangle ABC, cosecA(sinB.sinC+cosB.sinC) is equ...

In triangle ABC, cosecA(sinB.sinC+cosB.sinC) is equal to..?

SHOPPERS`STOP, 3. How are Indian customers visiting Shoppers’ Stop any diff...

3. How are Indian customers visiting Shoppers’ Stop any different from customers of developed western countries? 4. How should Shoppers’ Stop develop its demand forecasts?

How many hours will it take before the cars are 610 miles, Two commuters le...

Two commuters leave the similar city at the same time but travel in opposite directions. One car is traveling at an average speed of 63 miles per hour, and the other car is traveli

Rectilinear figure, what is a redtilinear figure? like what are for the req...

what is a redtilinear figure? like what are for the requirments for a shape to be called that? example a regular polygon has all sides and angles equal. i cant find that kind of dr

Ratio, how can i solve it

how can i solve it

Write a procedure to obtain the inverse of a matrix, Write a procedure to o...

Write a procedure to obtain the inverse of an n by n matrix usingGaussian elimination. (You cannot use A - 1 or any of the built-in packages like 'MatrixInverse'.) Output any a

Write Your Message!

Captcha
Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd