Describe the system with 3 variables, Mathematics

Assignment Help:

Describe the System with 3 Variables ?

This is an example of solving a system of equations using the substitution method. Warning: You will not understand this example if you try to read it quickly. Take your time, and try to understand where each step comes from.
Let's try a system of 3 equations, with 3 variables:

2x - y + z = -1 (3a)
x + z = -2 (3b)
-2x + y + z = -5 (3c)

Step 1: Solve the second equations for x. (We chose the second equation because it's simplest.)
x = -2 - z (4)
Step 2: Eliminate x from the other two equations, by substitution:

2x - y + z = -1
-2x + y + z = -5
2(-2 - z) - y + z = -1
-2(-2 - z) + y + z = -5
-4 -2z - y + z = -1
4 + 2z + y + z = -5
-y - z = 3 (5a)
y + 3z = -9 (5b)

Look! We've got it down to two variables instead of three!
Let's repeat steps 1 and 2, to get it down to one variable.
First, solve equation (5a) for y:

-y - z = 3
y = -3 - z (6)

Next, use substitution to eliminate y from (5b):

y + 3z = -9
(-3 - z) + 3z = -9
2z = -6
z = -3.
We've found the value of z ! We'll use this in equation (6) to find y:

y= -3 - z
= -3 - (-3)
= 0.

So we know z = -3 and y = 0. We'll use this in equation (4) to find x.
x= -2 - z (4)
= -2 -(-3)
=1.
Thus, the solution is x = 1, y = 0, z = -3.


Related Discussions:- Describe the system with 3 variables

Word problems, The sum of two numbers is 19, their difference is 5. find th...

The sum of two numbers is 19, their difference is 5. find the numbers

Limit, limit x APProaches infinity (1+1/x)x=e

limit x APProaches infinity (1+1/x)x=e

Express the gcd as a linear combination, Express the GCD of 48 and 18 as a ...

Express the GCD of 48 and 18 as a linear combination.              (Ans: Not unique) A=bq+r, where  o ≤  r 48=18x2+12 18=12x1+6 12=6x2+0 ∴ HCF (18,48) = 6 now  6

Compound angles, determine the exact value of cos (11*3.145/6)

determine the exact value of cos (11*3.145/6)

Properties of triangle, In triangle ABC, cosecA(sinB.sinC+cosB.sinC) is equ...

In triangle ABC, cosecA(sinB.sinC+cosB.sinC) is equal to..?

Mental math, i dint get how to do math promblems

i dint get how to do math promblems

Fractions, Mr. And Mrs. samuel visited Florida and purchased 120 oranges. ...

Mr. And Mrs. samuel visited Florida and purchased 120 oranges. They gave 1/4 of them to relatives, ate 1/12 of them in the hotel, and gave 1/3 of them to friends. The shipped the

Project, elliptical path of celestial bodies

elliptical path of celestial bodies

Julie had $500 how much money did julie spend, Julie had $500. She spent 20...

Julie had $500. She spent 20% of it on clothes and then 25% of the remaining money on CDs. How much money did Julie spend? Find out 20% of $500 by multiplying $500 by the decim

Write Your Message!

Captcha
Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd