Already have an account? Get multiple benefits of using own account!
Login in your account..!
Remember me
Don't have an account? Create your account in less than a minutes,
Forgot password? how can I recover my password now!
Enter right registered email to receive password!
Consider a database whose universe is a finite set of vertices V and whose unique relation .E is binary and encodes the edges of an undirected (resp., directed) graph G: (V, E). Each undirected edge between the nodes o and u (resp., directed edge from the node v to the node u) is encoded by the two atoms E (v, u) and E (u, v) (resp., by the single atom E (v, u)).
Consider the pairs of stucture (undirected (resp., directed) graphs) shown in Fig. 1. Suppose that the graphs are encoded in a database as explained above. For each pair, answer the following questions:
1. What is the smallest quantifier rank k for which the spoiler wins the k-move Ehrenfeucht-Fraisse game on the pair of structure?
2. Derive a Boolean first-order query from your winning strategy that is true on one structure but not on the other (you can use the equality relation between vertices).
If arg (a/b) = pi/2, then find the value of ((a+b)/(a-b)) where a,b are complex numbers. Ans) Arg (a/b) =Pi/2 Tan-1 (a/b)= Pi/2 A/B = tanP/2 ,therefore a/b=infinity.
Can you please explain what Quadratic functions are?
Binomial Mathematical Properties 1. The expected or mean value = n × p = np Whereas; n = Sample Size p = Probability of success 2. The variance = npq Whereas; q =
Consider the Solow growth model as given in the lecture notes using the Cobb-Douglas production function Y t = AK 1-α t L α t a) Set up the underlying nonlinear differen
In arithmetic, we deal with numbers. In contrast to this, in algebra, we deal with symbols. These symbols are often represented by lower case alphabets. One of th
In triangle ABC, cosecA(sinB.sinC+cosB.sinC) is equal to..?
Properties 1. ∫ b a f ( x ) dx = -∫ b a f ( x ) dx . We can interchange the limits on any definite integral, all that we have to do is tack a minus sign onto the integral
1. In Figure there are three cameras where the distance between the cameras is B, and all three cameras have the same focal length f. The disparity dL = x0 - xL, while the disparit
need help
INTEGRATION OF 1/(1+3 SIN^2 x)
Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!
whatsapp: +91-977-207-8620
Phone: +91-977-207-8620
Email: [email protected]
All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd