Which component of the mixture dissolved in the acetone

Assignment Help Chemistry
Reference no: EM13166315

An unknown solid mixture containing benzoic acid,copper(II)sulfate and sand. She added 15mL.of acetone to her sample. Which component of the mixture dissolved in the acetone?

Reference no: EM13166315

Questions Cloud

What is the identity of the metal : A metal crystallizes in a face-centered cubic lattice. The radius of the atom is 128 pm and the density of the element is 8.92 g/cm3. What is the identity of the metal?
Create a deque class based on the discussion of deques : Create a Deque class based on the discussion of deques (double-ended queues) in this chapter. It should include insertLeft(), insertRight(), removeLeft(), removeRight(), isEmpty(), and isFull() methods.
What pressure would have to be applied to steam : What pressure would have to be applied to steam at 365°C to condense the steam to liquid water (H vap = 40.7 kJ/mol)?
Compute the uncertainty in the position mosquito moving : Using Heisenberg's uncertainty principle, calculate the uncertainty in the position of a 1.50 mg mosquito moving at a speed
Which component of the mixture dissolved in the acetone : An unknown solid mixture containing benzoic acid,copper(II)sulfate and sand. She added 15mL.of acetone to her sample. Which component of the mixture dissolved in the acetone?
Parents work behavior affects children’s behavior and mood : Parents work behavior affects children’s behavior and mood. For example, when fathers and mothers are psychologically engaged in work, but are available at home some studies have suggested that their children children are more likely to become academ..
Explain why are homopolymers of polyethylene : Why are homopolymers of polyethylene and isotactic polypropylene rigid plastics, but ethylene-propylene (EPR) copolymer soft
Write a c++ program to choose two three-digit primes : Write a C++ program to choose two three-digit primes and an encryption exponent (3 or 17 may do nicely).
State the weak acid hz has a ka : The weak acid HZ has a ka of 2.55*10^-4. What is the pH of a .075 M HZ? What is the pOH of .045 M HZ?

Reviews

Write a Review

Chemistry Questions & Answers

  How many grams of water are formed

When a 1.90 mg sample of methane burns in excess oxygen, how many grams of water and carbon dioxide are formed?

  Explain how many molecules of acetyl coa are produced

Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

  What volume will the balloon occupy

A 7.0 liter balloon at room temperature (22 degrees celsius) contains hydrogen gas. If the balloon is carried outside to where the temperature is -3.0 degrees Celsius.

  Write the amino acid sequence in the n-terminal

write the amino acid sequence in the N-terminal to C-terminal direction. Use the three-letter amino acid abbreviations (for example, Glu-Asp-Val).

  Why is the peroxide anion such a strong oxidizing agent

Why is the peroxide anion such a strong oxidizing agent and describe qualitatively how the conclusions of Bohr and Rydberg are essentially the same?

  How many double bonds are present

How many double bonds are present in the "best" resonance structure of the phosphate ion?

  How many liters of h2 would be formed

how many liters of H2 would be formed at 628 mm Hg and 14 degrees celcius if 22.5g of zinc was allowed to react

  Calculate the enthalpy change for the dissolution

Calculate the enthalpy change for the dissolution of NH 4 NO 3 and expree your answer in units of kJ/mol.

  Calculate the molarity of a solution

Calculate the molarity of a solution made by dissolving 0.0715 mol Na2SO4 in enough water to form 550 mL of solution.

  How many milliliters of nahco3 must be poured

an auto mechanic spills 85 mL of 2.6 M H2SO4 solution from a rebuilt auto battery. How many milliliters of 2.5 M NaHCO3 must be poured on te spill to react completely with the sulfuric acid.

  Explain why are the crude ester mixtures washed with aqueous

Why are the crude ester mixtures washed with aqueous NaHCO3?2. You wish to test 9 esters for antitumor activity. One and only one of the 9 esters will actually have antitumor activity. You will prepare the esters from an alcohol and an acid as was..

  Determined by titrating with a standard solution

The purity of a 0.287 -g samole of Zn(OH)2 is determined by titrating with a standard solution, requiring 37.8 mL. The HCL solution was standardized by precipitating AgCl in a 25.0-mL aliquot

Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd