What is the mass fraction of o2

Assignment Help Chemistry
Reference no: EM13168019

A 5.00 L flask at 279 K contains a mixture of He and O2 with a total pressure of 1.00 atm. If the mole fraction of O2 is 0.40, what is the mass fraction of O2?

Reference no: EM13168019

Questions Cloud

How many moles of oxygen gas are needed : if you have 4 moles of hydrogen gas, how many moles of oxygen gas are needed for complete reaction?
Write the formula for the ion formed : Write the formula for the ion formed when each of the following elements loses its valence electrons?
Contacts class that contains an array : Create a Friend class that contains a first name, last name, a birthday, and a telephone number. Create a Contacts class that contains an array of Friend as well as the owner's name and cell phone Number.
What is the concentration of potassium hydroxide : 105 cm3 of 2MSulphuric acid is required to neutralise 420 cm3 of potassium hydroxide. What is the concentration of potassium hydroxide?
What is the mass fraction of o2 : A 5.00 L flask at 279 K contains a mixture of He and O2 with a total pressure of 1.00 atm. If the mole fraction of O2 is 0.40, what is the mass fraction of O2?
Create a console-based application named multiplication : a. Create a console-based application named Multiplication whose main() method asks the user to input and then calls a method named MultiplicationTable(), which displays the results of multiplying the integers by each of the number 2 through 10
Takes n number of element from user : Write a C program which takes n number of element from user (where, n is specified by user) and stores data in an array. Then, this program displays the largest element of that array.
What structure best represents the rate-determining : What structure best represents the rate-determining intermediate formed when 1-methylcyclopentene reacts with Cl2.
Calculate the number of excess reagent units remaining : calculate the number of excess reagent units remaining when 100 C4H10 molecules and 611 O2 molecules react?

Reviews

Write a Review

Chemistry Questions & Answers

  Why bromine is larger than chlorine

This is a fact that Bromine(Br) is larger than chlorine(Cl) but indication of equilibrium constant suggests that a bromo substituent has a less preference for the equatorial position than chloro substituent? Explain it briefly?

  What is the percent yield of the reaction

C2H4 Flows into a catalytic reactor at 25atm and 300 degrees C with a flow rate of 1010 L/min. Hydrogen at 25atm and 300 degrees C with a flow rate of 1050L/min. If 11.0kg of C2H6 are collected per minute, what's the percent yield of the reaction?

  What is the concentration of the final solution

Water is added to 25.0 ml of .716 MKNO3 solution until the volume of the solution is exactly 500 ml. What is the concentration of the final solution?

  What is the density of a piece of metal

what is the density of a piece of metal if it's mass is 201 g and its volume is 18.9 cm3

  Calculate the ph of a buffer formed

Calculate the pH of a buffer formed by mixing 60. mL of 0.10 M lactic acid with 88 mL of 0.24 M sodium lactate.

  What is the root-mean-square molecular speed of a gas

what is the root-mean-square molecular speed of a gas molecule of this smelly gas molecule at 25C?

  Determine the density of metal

We have noted that water level rises to 62.4mL when a piece of metal of 48 grams is dropped into 50.0mL of H 2 O in a graduated cylinder. Determine the density of this metal?

  Compute the hydroxide ion concentration

Compute the hydroxide ion concentration in a NH 3 solution that is 0.091 M and 0.028 M NH 4 Cl. Kb of NH 3 is 1.8 x 10 -5 .

  What is the pressure in the airplane

In an airplane, a gas sample occurs at a volume of 1.5 L at 760.0 torr. Suppose, while flying, the airplane loses pressure and the volume of the gas increases to 11.40 L.

  Calculate the amount of heat (in kj) associated

Consider the following equation: CO + 2 H2 → CH3OH ?H rxn = -128 kJ Calculate the amount of heat (in kJ) associated with complete reaction of 8.08 g H2.

  Explain how many molecules of acetyl coa are produced

Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

  Equation for the single-replacement oxidation-reduction

Write a balanced equation for the single-replacement oxidation-reduction reaction described, using the smallest possible integer coefficients

Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd