State what will the concentration of equilibrium

Assignment Help Chemistry
Reference no: EM13182697

1.)CO(g)+NH3(g)CHCONH2(g), Kc=0.820

If a reaction vessel initially contains only CO and NH3 at concentrations of 1.00 M and 2.00 M, respectively, what will the concentration of HCONH2 be at equilibrium?

2.)If the hydrogen atom is in the n=4 state, what is the larges number of photons that can be emitted as the atom goes back to the ground state?

Reference no: EM13182697

Questions Cloud

What will be the tax consequences of loan : Assuming that the loan is repaid in 2013 and Marc has always made his interest payments on time, what will be the tax consequences of this loan?
What government policy response would you recommend : Suppose there is a permanent fall in private aggregate demand for a country's output (a downward shift of the entire aggregate demand schedule). What is the effect on output? What government policy response would you recommend?
Brominated biphenyls pbb is created through an electrophilic : Brominated biphenyls (PBB) is created through an electrophilic aromatic bromization out of the hydrocarbon biphenyl.
How much is the dollar overvalued-undervalued : you are given the following information. the current dollar-pound exchange rate is 2 dollar per pound. A u.s. basket that costs 100dollar would cost 120 dollar in the UK. For the next year , the fed is predicted to keep US inflation at 2% and the ..
State what will the concentration of equilibrium : If a reaction vessel initially contains only CO and NH3 at concentrations of 1.00 M and 2.00 M, respectively, what will the concentration of HCONH2 be at equilibrium?
Explain potassium phosphate and potassium chloride : A mixture contains both potassium phosphate and potassium chloride. What is the percentage of potassium phosphate in this mixture if reaction of 0.401g of this mixture with excess copper (II) chloride yields 0.213g of copper (II) phosphate?
How might this policy be exasperating the recession : According to theory, if you lower interest rates, business investments and consumer purchases of large durable goods are supposed to increase. In return, this is to help pull us out of a recession. However, this policy of extraordinarily low inter..
State what volumes of sulfur dioxide and dihydrogen sulfide : What volumes of sulfur dioxide and dihydrogen sulfide gases are necessary to produce 11.4 L of water vapor? The balanced equation is SO2 + 2 H2S à 3 S + 2 H2O.
What happens if the economy is producing a level of output : we know that when an economy starts out at long-run equilibrium and the government cuts taxes, this will result in inflation int he long run. what happens if the economy is producing a level of output below the full employment (long run equilibriu..

Reviews

Write a Review

Chemistry Questions & Answers

  What is the specific heat capacity of the metal

A piece of metal of mass 22 g at 92C is placed in a calorimeter containing 53.7 g of water at 21C. The final temperature of the mixture is 55.3C. What is the specific heat capacity of the metal?

  Describe strong weak and concentrated dilute

strong/weak and concentrated/dilute. Provide an appropriate example using each of these terms to describe a solution

  Calculate q, w, and e for melting of ice

The standard molar heat of fusion of ice is 6020 J/mol. Calculate q, w, and E for melting 1.00 mol of ice at 0C and 1.00 atm pressure.

  Calculate the equilibrium concentrations of the gases

If all four gases had initial concentrations of 0.650 M, calculate the equilibrium concentrations of the gases.

  Compute the ph of a buffer that contains ammonium chloride

Calculate the pH of a buffer that contains 0.060M ammonium chloride

  State the edta solution and the average volume of edta

Use the molarity of the EDTA solution and the average volume of EDTA added to calculate the average number of moles of EDTA required for the titration.

  What is the chemical name for cuso4

What is the chemical name for CuSO4? a. Copper sulphate b. Copper sulphur oxide c. Copper (II) sulphate d. Copper (I) sulphate

  An existing power plant has been found to produce so2

An existing power plant has been found to produce SO2 concentration of 20?g/m3 at a distance of 800m directly downwind from the stack when the wind is 4m/s from the north during a class C stability situation.

  Explain why it takes longer time when anyone cook an egg

Explain why it takes longer time when anyone cook an egg in boiling water while camping at in elevation of 0.5km in the mountain than it does it home.

  Explain how many molecules of acetyl coa are produced

Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

  How many grams of na2so4 will be formed

50.0 mL of 2.00 M H2SO4 react with 75.0 mL of 2.00M NaOH. Identify the limiting and excess reactants. How many grams of Na2SO4 will be formed.

  How can find beaker contains pure water

One beaker contains pure water, another contains salt water, and another contains sugar water. How can you tell the which beaker is Which?

Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd