Already have an account? Get multiple benefits of using own account!
Login in your account..!
Remember me
Don't have an account? Create your account in less than a minutes,
Forgot password? how can I recover my password now!
Enter right registered email to receive password!
1.)CO(g)+NH3(g)CHCONH2(g), Kc=0.820
If a reaction vessel initially contains only CO and NH3 at concentrations of 1.00 M and 2.00 M, respectively, what will the concentration of HCONH2 be at equilibrium?
2.)If the hydrogen atom is in the n=4 state, what is the larges number of photons that can be emitted as the atom goes back to the ground state?
A piece of metal of mass 22 g at 92C is placed in a calorimeter containing 53.7 g of water at 21C. The final temperature of the mixture is 55.3C. What is the specific heat capacity of the metal?
strong/weak and concentrated/dilute. Provide an appropriate example using each of these terms to describe a solution
The standard molar heat of fusion of ice is 6020 J/mol. Calculate q, w, and E for melting 1.00 mol of ice at 0C and 1.00 atm pressure.
If all four gases had initial concentrations of 0.650 M, calculate the equilibrium concentrations of the gases.
Calculate the pH of a buffer that contains 0.060M ammonium chloride
Use the molarity of the EDTA solution and the average volume of EDTA added to calculate the average number of moles of EDTA required for the titration.
What is the chemical name for CuSO4? a. Copper sulphate b. Copper sulphur oxide c. Copper (II) sulphate d. Copper (I) sulphate
An existing power plant has been found to produce SO2 concentration of 20?g/m3 at a distance of 800m directly downwind from the stack when the wind is 4m/s from the north during a class C stability situation.
Explain why it takes longer time when anyone cook an egg in boiling water while camping at in elevation of 0.5km in the mountain than it does it home.
Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid
50.0 mL of 2.00 M H2SO4 react with 75.0 mL of 2.00M NaOH. Identify the limiting and excess reactants. How many grams of Na2SO4 will be formed.
One beaker contains pure water, another contains salt water, and another contains sugar water. How can you tell the which beaker is Which?
Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!
whatsapp: +1-415-670-9521
Phone: +1-415-670-9521
Email: [email protected]
All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd