How much heat is removed from your body

Reference no: EM13130577

The heat of vaporization of water is 40.66 kJ/mol. Assuming sweat is 100% water, how much heat is removed from your body through the evaporation of 3.13 g of sweat?

Reference no: EM13130577

Questions Cloud

Explain is sample result is unusually small : One of the herpetologists fears that pollution might be affecting the natural growth of the pythons. Do you think this sample result is unusually small? Explain. Show work.

What is the target variable cost per mouse : A company believes it can sell 5,000,000 of its proposed new optical mouse at a price of $11.00 each. There will be $8,000,000 in fixed costs associated with the mouse. If the company desires to make a profit $2,000,000 on the mouse, what is the t..

Information regarding exchange rates : Determine the above rates in other quotation format ( i.e. if above rates are quoted indirectly,calculate direct quotation,and vice versa) Please provide your answer in proper manner ( i.e. XX per YY)

Explain how many molecules of acetyl coa are produced : Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

How much heat is removed from your body : The heat of vaporization of water is 40.66 kJ/mol. Assuming sweat is 100% water, how much heat is removed from your body through the evaporation of 3.13 g of sweat?

Determine the direct cost of running a red light : If the probability of getting caught is .02, the probability of getting a ticket is .97 and the probabiity of having to pay the ticket is .94, what is the direct cost of running a red light.

Percentages and amount of concentrate needed : A container will hold 1 ltr, you will need the following solutions for different purposes, how much concentrate will you need in each case.

What will the total pressure in the vessel be at equilibrium : If the reaction 2H2S(g) ↔ 2H2(g) + S2(g) is carried out at 1065°C, Kp = 0.0120. Starting from pure H2S introduced into an evacuated vessel at 1065°C.

Giving examples give the mechanisms of aldol condensation : Giving examples give the mechanisms of Aldol condensation between two molecules of aldehydes and two molecules of ketones

User Account

All Pages