How many grams of ethyl butrate would be synthesized

Reference no: EM13710695

Problem- Ethyl butyrate, CH3 CH2 CH2 CH2 CH2 CH3 is an artifical fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring. It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+): CH3CH2CH@CO2H(1)+CH2CH3OH(1) -> CH3CH2CH2CO2CH2CH3(1) + H2o(1).

Part A Given 7.80 of butanoic acid and excess ethanol , how many grams of ethyl butrate would be synthesized , assuming a complete 100% yield?

Part B: A chemist ran the reaction and obtained 5.15g of ethyl butyrate. What was the percent yield?

Explain the each step. Explain the process and each step.

Reference no: EM13710695

Questions Cloud

Case study - the probuild constructions story : Why do employees value opportunities for workplace flexibility? Would this strategy work in all organisations and industries and is it possible for companies to be competitive and at the same time create a workplace that provides for flexibility and..

What is the major product of the reaction : What is the major product of the following reaction. Show mechanism and name product(s)] CH3CH=CH2 HCL/ excess

Calculate the wavelength of these nuclear rays : Problem- The -ray photons emitted by the nuclear decay of a technetium-99 atom used in radiopharmaceuticals have an energy of 140.511 keV. Calculate the wavelength of these -rays.

What is the half life of the reaction kinetics : Problem- After 71.0 minutes 42.0 percent of a compound is decomposed. What is the half life of the reaction assuming first order kinetics

How many grams of ethyl butrate would be synthesized : Part A Given 7.80 of butanoic acid and excess ethanol , how many grams of ethyl butrate would be synthesized , assuming a complete 100% yield

What is the solubility of pbso4 in water at 25c : What is the solubility of PbSO4 in water at 25C if the solution already contains 0.25M Na2SO4. (Ksp for PbSO4 is 2.5 x 10^-8)

What is the solubility of pbso4 in water solution : What is the solubility of PbSO4 in water at 25C if the solution already contains 0.25M Na2SO4. (Ksp for PbSO4 is 2.5 x 10^-8) include the solubility before the Na2SO4 is added.

Calculate how many moles of no2 amount of reactant : Problem- For the reaction shown, calculate how many moles of NO2 form when each amount of reactant completely reacts. 2 N2O5(g) -> 4 NO2(g) + O2(g). Part c 11.0g N2O5 and Part D 1.25kg N2O5

Calculate the ph of the mixture of acids : Calculate the pH of the following mixture of acids: 100 mL solution containing 65 mL of 0.500 M acetic acid (CH3COOH - Ka = 1.8 x 10-5) and 35 mL of 0.300 M benzoic acid (C6H5COOH - Ka = 6.3 x 10-5).

User Account

All Pages