Fatty acids from highest melting point

Assignment Help Biology

Reference no: EM1385632

Rank the following fatty acids from highest melting point to lowest melting point:

A) CH3(CH2)4(CH=CHCH2)4(CH2)2COOH

B) CH3(CH2)7CH=CH(CH2)7COOH

C) CH3(CH2)10COOH

D) CH3(CH2)14COOH

Which of the following four statements about fatty acid melting points are true? More then one can be correct.

1. A saturated fatty acid with a greater molecular weight has a higher melting point than a saturated fatty acid with a lower molecular weight.

2. A saturated fatty acid with a greater molecular weight has a lower melting point than a saturated fatty acid with a lower molecular weight.

3. A saturated fatty acid has a higher melting point than an unsaturated fatty acid.

4. A saturated fatty acid has a lower melting point than an unsaturated fatty acid.

Reference no: EM1385632

Questions Cloud

There are some negotiators who will use dirty tricks : There are some negotiators who will use "dirty tricks" during negotiations to attempt to gain an advantage over the other party.

Show rewsult of inserting these keys using double hashing : Show the result of inserting these keys using linear probing, using quadratic probing with c1 = 1and c2 = 3, and by using double hashing with h2(k) = 1 + (k mod (m-1)).

Gravity when a person drinks large amount of water : Will a person suffering from dehydration have urine with high or low specific gravity? What will happen to specific gravity when a person drinks large amount of water?

How would you explain this outcome when intuitively : How would you explain this outcome when intuitively you would think that a negotiator who is more focused on power would be more successful?

Fatty acids from highest melting point : Rank the given fatty acids from highest melting point to lowest melting point:

Factor of safety against overturning : Determine the factor of safety against overturning about point A if = 3 .The factor of safety is defined as the ratio of the stabilizing moment divided by the overturning moment.

The current break-even points in units is : The local convenience store makes personal pan pizzas. Currently, their oven can produce 50 pizzas per hour. It has a fiixed cost of $2,000, and a variable cost of $0.25 per pizza.

Example of humans evolution : Give one example of humans evolving over the past 10,000 years. Explain why and how evolution is take place?

What is a meaningful life : What do you think is the main feature of a good life? Do you think a good life must be measured on daily basis, or at the end of your life? What difference would this make?

User Account

All Pages