Explain an artificial fruit flavor commonly used in the food

Reference no: EM13699379

Problem- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commonly used as orange flavoring.

It can be produced by the reaction of butanoic acid with ethanol in the presence of an acid catalyst (H+):

CH3CH2CH2CO2H(l)+CH2CH3OH(l)H+?CH3CH2CH2CO2CH2CH3(l)+H2O(l)

Given 8.10g of butanoic acid and excess ethanol, how many grams of ethyl butyrate would be synthesized, assuming a complete 100% yield?

A chemist ran the reaction and obtained 5.45g of ethyl butyrate. What was the percent yield?

I just need a general explanation of it please- Thanks

Reference no: EM13699379

Questions Cloud

Method to generate the random numbers : Write a program that will generate a set of 75 random integers in the range -26 to + 42. The program should display the following:

Calculate the final temperature of a mixture of ice : Problem- Calculate the final temperature of a mixture of 150.0 g of ice initially at -14.0C and 371.5 g of water initially at 91.5C

How many carbon atoms butane : Problem- The fuel used in many disposable lighters is liquid butane, C4H10. How many carbon atoms are in 4.00g of butane

Submit the given circuit drawn in multisim : Ensure to use only MULTI SIM and please attach ALL screen shots for the steps thanks!!

Explain an artificial fruit flavor commonly used in the food : Problem- Ethyl butyrate, CH3CH2CH2CO2CH2CH3, is an artificial fruit flavor commonly used in the food industry for such flavors as orange and pineapple. Its fragrance and taste are often associated with fresh orange juice, and thus it is most commo..

Can you name the country which contributed the video display : It had chips from Intel, disk drives from Tendon, operating system from Microsoft, the printer from Epson and the application software from everywhere.

You need to prepare a program linear solver : Write a C program, called linear solver.c, that solves single-variable linear equations. The pro- gram should prompt the user to enter a linear equation of the form

Determine the number of bromine molecules present : Problem- A flask contains 0.350mol of liquid bromine, Br2. Determine the number of bromine molecules present in the flask.

Calculate the percent composition of the hydrocarbon : Problem- A hydrocarbon is a compound that contains mostly carbon and hydrogen. Calculate the percent composition (by mass) of the following hydrocarbon: C 6 H 14.

User Account

All Pages