Determine the direct cost of running a red light

Reference no: EM13130576

The fine for running a red light increases to $300. If the probability of getting caught is .02, the probability of getting a ticket is .97 and the probabiity of having to pay the ticket is .94, what is the direct cost of running a red light.

Reference no: EM13130576

Questions Cloud

What is the target variable cost per mouse : A company believes it can sell 5,000,000 of its proposed new optical mouse at a price of $11.00 each. There will be $8,000,000 in fixed costs associated with the mouse. If the company desires to make a profit $2,000,000 on the mouse, what is the t..

Information regarding exchange rates : Determine the above rates in other quotation format ( i.e. if above rates are quoted indirectly,calculate direct quotation,and vice versa) Please provide your answer in proper manner ( i.e. XX per YY)

Explain how many molecules of acetyl coa are produced : Olive oil is comprised of 80% oleic acid, CH3(CH2)7CH=CH(CH2)7COOH. How many molecules of acetyl CoA are produced by catabolism of oleic acid

How much heat is removed from your body : The heat of vaporization of water is 40.66 kJ/mol. Assuming sweat is 100% water, how much heat is removed from your body through the evaporation of 3.13 g of sweat?

Determine the direct cost of running a red light : If the probability of getting caught is .02, the probability of getting a ticket is .97 and the probabiity of having to pay the ticket is .94, what is the direct cost of running a red light.

Percentages and amount of concentrate needed : A container will hold 1 ltr, you will need the following solutions for different purposes, how much concentrate will you need in each case.

What will the total pressure in the vessel be at equilibrium : If the reaction 2H2S(g) ↔ 2H2(g) + S2(g) is carried out at 1065°C, Kp = 0.0120. Starting from pure H2S introduced into an evacuated vessel at 1065°C.

Giving examples give the mechanisms of aldol condensation : Giving examples give the mechanisms of Aldol condensation between two molecules of aldehydes and two molecules of ketones

Look at news media : When you look at news media, where do you most strongly see evidence of bias? Be specific and explain your experiences.

User Account

All Pages