Define diethyl malonate to ethanal in the presence of base

Reference no: EM13134160

Mechanism and synthesis
A.) Write a complete mechanism for the addition of diethyl malonate to ethanal in the presence of base to form a beta-hydroxy ester.

B.) Outline a sythensis that forms at least on C - C bond for each of the following compounds:
1.) CH3CH2CH2CH2CH2CH=CHCO2H
2.) CH3CH2CH2CH=C(CN)(CO2CH2CH3)

Reference no: EM13134160

Questions Cloud

Explain use ir tables to locate absorption bands : Use IR tables to locate absorption bands of the stretching frequencies of the alkyne C

Explain how the power of hypothesis test is influenced : Explain how the power of hypothesis test is influenced by each of the following. Assume that all other factors are held constant. Increasing the alpha level from .01 to .05.

Solid from revolution of right triangle : A right triangle with legs of 5 and 12 is rotated about it's hypotenuse to form a solid which is pointed at two ends. What is the volume of that solid?

Policies and procedure of internal control : Explain why internal control is an important aspect of an accounting system, providing at least two specific example that would be in the policies and procedure of internal control.

Define diethyl malonate to ethanal in the presence of base : Write a complete mechanism for the addition of diethyl malonate to ethanal in the presence of base to form a beta-hydroxy ester.

Ratio of area of triangle to hexagon : An equilateral triangle and a regular hexagon have equal perimeters. What is the ratio of the area of the triangle to the area of the hexagon?

How standard deviation influences outcome hypothesis test : Briefly describe how the standard deviation influences the outcome of the hypothesis test. How does standard deviation influence measures of effect size?

Define and discuss mental health, mental disorders, and dsm : Define and discuss mental health, mental disorders, and DSM-IV-TR. What is the use and importance of the DSM-IV-TR in American healthcare?

Prove the theorem of broken chord : The theory of the broken chord asserts that if AB and BC make up a broken chord in a circle, where BC > AB and if M is the midpoint of arc ABC, the foot F of the perpendicular from M on BC is the midpoint of the broken chord ABC.

User Account

All Pages