A car speeds along the curved exit ramp of a freeway

Assignment Help Physics
Reference no: EM13648868

A car speeds along the curved exit ramp of a freeway. The radius ofthe curve is 86 m. A 68 kg passenger holds the arm rest of a car door witha 220 N force to keep from sliding across the front seat of thecar. (Assume the exit ramp is not banked and ignore friction withthe car seat.) What is the car's speed?

Reference no: EM13648868

Questions Cloud

Find the speed of the electron and find the magnetic field : An electron with kinetic energy 3.10keV circles in a plane perpendicular to a uniform magnetic field. The orbit radius is47.0cm. Find the speed of the electron. Find the magnetic field.
Examine the role monica plays as a wife and mother : How is that role similar and different to the role of a wife and mother played today? You might want to focus first on Monica's actions after Augustine "ditches" her on his way to Rome.
Compute the delta h using standard enthalpies of formation : Hydrazine(N2H4) is a fuel used by some spacecraft. It is normally oxidized by N2O4 according to the following equation: N2H4(l)+N2O4(g)=2N2O(g)+2H2O(g)
Estimate what is the maximum weight it can lift : A 0.10-kg balloon is filled with helium(density = 0.179 kg/m3). If the balloon is a sphere witha radius of 6.3 m, what is the maximum weight it can lift
A car speeds along the curved exit ramp of a freeway : A car speeds along the curved exit ramp of a freeway. The radius ofthe curve is 86 m. A 68 kg passenger holds the arm rest of a car door witha 220 N force to keep from sliding across the front seat of thecar.
Evaluate what is the frequency of the wheel : A potter's wheel is rotating around a vertical axis through itscenter at a frequency of 1.7 rev/s. What is the frequency of the wheel after the clay sticks to it
Describe the evolution of the religious works : Describe the evolution of the religious works published during this time. What kinds of religious works were published between 43 BCE and 1066 AD?
Determine the angle that string makes withthe horizontal : A 116 g stone is whirled in a horizontalcircle on the end of an 75 cm long string.The stone takes 1.3 s to make eachcomplete revolution. Determine the angle that the string makes withthe horizontal.
Define what is the wavelength of the photon in nanometers : A photon of light has a frequency of 2.80x1014 Hz. What is the wavelength of the photon in units of nanometers

Reviews

Write a Review

Physics Questions & Answers

  Determine what will the timer read

A solid cylinder is released from rest and rolls without slipping down a 4.0 degree incline. what will the timer read

  What is the crankshafts angular acceleration

The crankshaft in a race car goes from rest to 3000 rpm in 2.0seconds. What is the crankshafts angular acceleration?

  Find the resultant a magnitude and b directional angle of

the three displacement vectors in the drawing have magnitudes of a 3.73 m b 4.62 m and c 5.20 m. find the resultant

  A gold wire and a tungsten wire of the same length have the

a gold wire and a tungsten wire of the same length have the same resistance. what is the ratio of the diameter of the

  What is the index of refraction of the material

The frequency of an electromagnetic wave is f = 3.75 x 1014 Hz, What is the index of refraction n of the material

  Blowing across a narrow mouth glass-less wter in glass

When blowing across a narrow mouth glass, the less wter in theglass the deeper the frequency heard, but if the top of the glessis rubbed to produce the less water, the higher frequency, why?

  Calculate the total magnification

The eyepiece of a compound microscope has a focal length of 3.10 cm, and the objective lens has f = 0.730 cm. Calculate the total magnification

  Determine its maximum speed and acceleration

A 500 gram mass oscillates with an amplitude 9.0cm and a frequency of 1.8 Hz. Determine its MAXIMUM speed and acceleration, and its speed when it is 4cm from its equilibrium position.

  Angular momentum of the particle about origin as function

The position vector of a particle of mass 1.80 kg as a function of time is given by r = (6.00i + 4.60t j ), where r is in meters and t is in seconds. Determine the angular momentum of the particle about the origin as a function of time. Answer should..

  What distance db would the bird cover

A force of 315 N is applied horizontally to a wooden crate in order to displac eit 35.0 m accorss a level surface at a constant velocity. As a result of this work the crate's internal energy is increased by an amount equal to 14 percent of the cra..

  Define how does reaction time affect emergency situations

How does reaction time affect emergency situations, like braking in a car? Estimate the distance a car travels at 100km/hr due to your reaction time in braking

  Evaluate the amplitude of the resulting oscillation

A spring hanging from the ceiling has an unstretched length of 80cm. What is the amplitude of the resulting oscillation

Free Assignment Quote

Assured A++ Grade

Get guaranteed satisfaction & time on delivery in every assignment order you paid with us! We ensure premium quality solution document along with free turntin report!

All rights reserved! Copyrights ©2019-2020 ExpertsMind IT Educational Pvt Ltd